EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6INO5 |
| Net Charge | 0 |
| Average Mass | 323.042 |
| Monoisotopic Mass | 322.92907 |
| SMILES | O=C(O)Cc1cc(I)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H6INO5/c9-5-1-4(3-7(11)12)2-6(8(5)13)10(14)15/h1-2,13H,3H2,(H,11,12) |
| InChIKey | KPWFDZXSCIFGNO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) has role antigen (CHEBI:59132) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) is a 2-nitrophenols (CHEBI:86421) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) is a organoiodine compound (CHEBI:37142) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) is a phenylacetic acids (CHEBI:25978) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) is conjugate acid of (4-hydroxy-5-iodo-3-nitrophenyl)acetate (CHEBI:53799) |
| Incoming Relation(s) |
| 1-((4-hydroxy-5-iodo-3-nitrophenyl)acetoxy)pyrrolidine-2,5-dione (CHEBI:55343) has functional parent (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) |
| (4-hydroxy-5-iodo-3-nitrophenyl)acetate (CHEBI:53799) is conjugate base of (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) |
| (4-hydroxy-3-iodo-5-nitrophenyl)acetyl group (CHEBI:53797) is substituent group from (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid (CHEBI:53798) |
| IUPAC Name |
|---|
| (4-hydroxy-3-iodo-5-nitrophenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-3-iodo-5-nitrophenyl)acetic acid | ChEBI |
| 4-hydroxy-3-iodo-5-nitro-benzeneacetic acid | ChemIDplus |
| 4-hydroxy-3-iodo-5-nitrobenzeneacetic acid | ChEBI |
| (4-hydroxy-5-iodo-3-nitrophenyl)acetic acid | ChEBI |
| Nip-hapten | ChemIDplus |
| Nitrohydroxyiodophenylacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14508005 | Reaxys |
| CAS:2646-51-7 | ChemIDplus |
| Citations |
|---|