EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O2 |
| Net Charge | 0 |
| Average Mass | 232.283 |
| Monoisotopic Mass | 232.12118 |
| SMILES | CC[C@]1(c2ccc(N)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17)/t13-/m1/s1 |
| InChIKey | ROBVIMPUHSLWNV-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| Applications: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-aminoglutethimide (CHEBI:53788) is a aminoglutethimide (CHEBI:2654) |
| (R)-aminoglutethimide (CHEBI:53788) is enantiomer of (S)-aminoglutethimide (CHEBI:53790) |
| Incoming Relation(s) |
| (S)-aminoglutethimide (CHEBI:53790) is enantiomer of (R)-aminoglutethimide (CHEBI:53788) |
| IUPAC Name |
|---|
| (3R)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| Synonym | Source |
|---|---|
| (+)-3-(4-Aminophenyl)-3-ethyl-2,6-piperidinedione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB00357 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:481673 | Beilstein |
| CAS:55511-44-9 | ChemIDplus |