EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53788 - (R)-aminoglutethimide
| Formula | C13H16N2O2 |
| Net Charge | 0 |
| Average Mass | 232.283 |
| Monoisotopic Mass | 232.12118 |
| SMILES | CC[C@]1(c2ccc(N)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17)/t13-/m1/s1 |
| InChIKey | ROBVIMPUHSLWNV-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Applications: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-aminoglutethimide (CHEBI:53788) is a aminoglutethimide (CHEBI:2654) |
| (R)-aminoglutethimide (CHEBI:53788) is enantiomer of (S)-aminoglutethimide (CHEBI:53790) |
| Incoming Relation(s) |
| (S)-aminoglutethimide (CHEBI:53790) is enantiomer of (R)-aminoglutethimide (CHEBI:53788) |
| IUPAC Name |
|---|
| (3R)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| Synonym | Source |
|---|---|
| (+)-3-(4-Aminophenyl)-3-ethyl-2,6-piperidinedione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB00357 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:481673 | Beilstein |
| CAS:55511-44-9 | ChemIDplus |