EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2654 - aminoglutethimide
| Formula | C13H16N2O2 |
| Net Charge | 0 |
| Average Mass | 232.283 |
| Monoisotopic Mass | 232.12118 |
| SMILES | CCC1(c2ccc(N)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17) |
| InChIKey | ROBVIMPUHSLWNV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminoglutethimide (CHEBI:2654) has functional parent piperidine-2,6-dione (CHEBI:5435) |
| aminoglutethimide (CHEBI:2654) has role adrenergic agent (CHEBI:37962) |
| aminoglutethimide (CHEBI:2654) has role anticonvulsant (CHEBI:35623) |
| aminoglutethimide (CHEBI:2654) has role antineoplastic agent (CHEBI:35610) |
| aminoglutethimide (CHEBI:2654) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| aminoglutethimide (CHEBI:2654) is a dicarboximide (CHEBI:35356) |
| aminoglutethimide (CHEBI:2654) is a piperidones (CHEBI:48589) |
| aminoglutethimide (CHEBI:2654) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| (R)-aminoglutethimide (CHEBI:53788) is a aminoglutethimide (CHEBI:2654) |
| (S)-aminoglutethimide (CHEBI:53790) is a aminoglutethimide (CHEBI:2654) |
| IUPAC Name |
|---|
| 3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| INNs | Source |
|---|---|
| aminoglutethimide | KEGG DRUG |
| aminoglutethimidum | ChemIDplus |
| aminoglutetimida | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-Aminophenyl)-2-ethylglutarimide | ChemIDplus |
| 3-Ethyl-3-(p-aminophenyl)-2,6-dioxopiperidine | ChemIDplus |
| p-Aminoglutethimide | ChemIDplus |
| P-Aminoglutethimide | DrugBank |
| DL-Aminoglutethimide | DrugBank |
| α-(p-Aminophenyl)-α-ethylglutarimide | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 164 | DrugCentral |
| Aminoglutethimide | Wikipedia |
| C07617 | KEGG COMPOUND |
| D00574 | KEGG DRUG |
| DB00357 | DrugBank |
| HMDB0014501 | HMDB |
| LSM-1409 | LINCS |
| US2848455 | Patent |
| Citations |
|---|