EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2654 - aminoglutethimide
| Formula | C13H16N2O2 |
| Net Charge | 0 |
| Average Mass | 232.283 |
| Monoisotopic Mass | 232.12118 |
| SMILES | CCC1(c2ccc(N)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17) |
| InChIKey | ROBVIMPUHSLWNV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Applications: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminoglutethimide (CHEBI:2654) has functional parent piperidine-2,6-dione (CHEBI:5435) |
| aminoglutethimide (CHEBI:2654) has role adrenergic agent (CHEBI:37962) |
| aminoglutethimide (CHEBI:2654) has role anticonvulsant (CHEBI:35623) |
| aminoglutethimide (CHEBI:2654) has role antineoplastic agent (CHEBI:35610) |
| aminoglutethimide (CHEBI:2654) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| aminoglutethimide (CHEBI:2654) is a dicarboximide (CHEBI:35356) |
| aminoglutethimide (CHEBI:2654) is a piperidones (CHEBI:48589) |
| aminoglutethimide (CHEBI:2654) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| (R)-aminoglutethimide (CHEBI:53788) is a aminoglutethimide (CHEBI:2654) |
| (S)-aminoglutethimide (CHEBI:53790) is a aminoglutethimide (CHEBI:2654) |
| IUPAC Name |
|---|
| 3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| INNs | Source |
|---|---|
| aminoglutethimide | KEGG DRUG |
| aminoglutethimidum | ChemIDplus |
| aminoglutetimida | ChemIDplus |
| Synonyms | Source |
|---|---|
| DL-Aminoglutethimide | DrugBank |
| P-Aminoglutethimide | DrugBank |
| 2-(p-Aminophenyl)-2-ethylglutarimide | ChemIDplus |
| 3-Ethyl-3-(p-aminophenyl)-2,6-dioxopiperidine | ChemIDplus |
| p-Aminoglutethimide | ChemIDplus |
| α-(p-Aminophenyl)-α-ethylglutarimide | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C07617 | KEGG COMPOUND |
| D00574 | KEGG DRUG |
| DB00357 | DrugBank |
| US2848455 | Patent |
| Aminoglutethimide | Wikipedia |
| HMDB0014501 | HMDB |
| LSM-1409 | LINCS |
| 164 | DrugCentral |
| Citations |
|---|