EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C17H18N4O.Cl |
| Net Charge | 0 |
| Average Mass | 330.819 |
| Monoisotopic Mass | 330.12474 |
| SMILES | Cc1ncnc1CN1CCc2c(c3ccccc3n2C)C1=O.[Cl-].[H+] |
| InChI | InChI=1S/C17H18N4O.ClH/c1-11-13(19-10-18-11)9-21-8-7-15-16(17(21)22)12-5-3-4-6-14(12)20(15)2;/h3-6,10H,7-9H2,1-2H3,(H,18,19);1H |
| InChIKey | FNYQZOVOVDSGJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alosetron hydrochloride (CHEBI:53783) has part alosetron (CHEBI:253342) |
| alosetron hydrochloride (CHEBI:53783) has role antiemetic (CHEBI:50919) |
| alosetron hydrochloride (CHEBI:53783) has role serotonergic antagonist (CHEBI:48279) |
| alosetron hydrochloride (CHEBI:53783) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one hydrochloride |
| INN | Source |
|---|---|
| alosetron | ChEBI |
| Synonyms | Source |
|---|---|
| 2,3,4,5-Tetrahydro-5-methyl-2-((5-methylimidazol-4-yl)methyl)-1H-pyrido(4,3-b)indol-1-one monohydrochloride | ChemIDplus |
| Alosetron HCl | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8455746 | Beilstein |
| CAS:122852-69-1 | KEGG DRUG |
| CAS:122852-69-1 | ChemIDplus |