EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C17H18N4O.Cl |
| Net Charge | 0 |
| Average Mass | 330.819 |
| Monoisotopic Mass | 330.12474 |
| SMILES | Cc1ncnc1CN1CCc2c(c3ccccc3n2C)C1=O.[Cl-].[H+] |
| InChI | InChI=1S/C17H18N4O.ClH/c1-11-13(19-10-18-11)9-21-8-7-15-16(17(21)22)12-5-3-4-6-14(12)20(15)2;/h3-6,10H,7-9H2,1-2H3,(H,18,19);1H |
| InChIKey | FNYQZOVOVDSGJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alosetron hydrochloride (CHEBI:53783) has part alosetron (CHEBI:253342) |
| alosetron hydrochloride (CHEBI:53783) has role antiemetic (CHEBI:50919) |
| alosetron hydrochloride (CHEBI:53783) has role serotonergic antagonist (CHEBI:48279) |
| alosetron hydrochloride (CHEBI:53783) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one hydrochloride |
| INN | Source |
|---|---|
| alosetron | ChEBI |
| Synonyms | Source |
|---|---|
| 2,3,4,5-Tetrahydro-5-methyl-2-((5-methylimidazol-4-yl)methyl)-1H-pyrido(4,3-b)indol-1-one monohydrochloride | ChemIDplus |
| Alosetron HCl | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8455746 | Beilstein |
| CAS:122852-69-1 | KEGG DRUG |
| CAS:122852-69-1 | ChemIDplus |