EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N4O |
| Net Charge | 0 |
| Average Mass | 294.358 |
| Monoisotopic Mass | 294.14806 |
| SMILES | Cc1ncnc1CN1CCc2c(c3ccccc3n2C)C1=O |
| InChI | InChI=1S/C17H18N4O/c1-11-13(19-10-18-11)9-21-8-7-15-16(17(21)22)12-5-3-4-6-14(12)20(15)2/h3-6,10H,7-9H2,1-2H3,(H,18,19) |
| InChIKey | JSWZEAMFRNKZNL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alosetron (CHEBI:253342) has role antiemetic (CHEBI:50919) |
| alosetron (CHEBI:253342) has role gastrointestinal drug (CHEBI:55324) |
| alosetron (CHEBI:253342) has role serotonergic antagonist (CHEBI:48279) |
| alosetron (CHEBI:253342) is a imidazoles (CHEBI:24780) |
| alosetron (CHEBI:253342) is a pyridoindole (CHEBI:48888) |
| Incoming Relation(s) |
| alosetron hydrochloride (CHEBI:53783) has part alosetron (CHEBI:253342) |
| IUPAC Name |
|---|
| 5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one |
| INN | Source |
|---|---|
| alosetron | KEGG DRUG |
| Synonym | Source |
|---|---|
| 2,3,4,5-Tetrahydro-5-methyl-2-((5-methyl-1H-imidazol-4-yl)methyl)-1H-pyrido(4,3-b)indol-1-one | ChemIDplus |