EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29F2N7.2CH4O3S |
| Net Charge | 0 |
| Average Mass | 669.777 |
| Monoisotopic Mass | 669.22148 |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C26H29F2N7.2CH4O3S/c1-3-13-29-24-31-25(30-14-4-2)33-26(32-24)35-17-15-34(16-18-35)23(19-5-9-21(27)10-6-19)20-7-11-22(28)12-8-20;2*1-5(2,3)4/h3-12,23H,1-2,13-18H2,(H2,29,30,31,32,33);2*1H3,(H,2,3,4) |
| InChIKey | MRDBGMJEPGXQHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| almitrine dimesylate (CHEBI:53779) has part almitrine (CHEBI:53778) |
| almitrine dimesylate (CHEBI:53779) has role central nervous system stimulant (CHEBI:35337) |
| almitrine dimesylate (CHEBI:53779) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| N,N'-diallyl-6-{4-[bis(4-fluorophenyl)methyl]piperazin-1-yl}-1,3,5-triazine-2,4-diamine dimethanesulfonate |
| Synonyms | Source |
|---|---|
| Almitrine mesylate | KEGG DRUG |
| Almitrine bismesylate | DrugBank |
| Almitrine dimethanesulfonate | ChemIDplus |
| (Diallylamino-4'-6'-triazinyl-2')-1-(bis p-fluorobenzydryl)-4 piperazine bis methanesulfonate | ChemIDplus |
| 2,4-Bis(allylamino)-6-(4-(bis(p-fluorophenyl)methyl)-1-piperazinyl)-s-triazine dimethanesulfonate | ChemIDplus |
| 6-(4-(Bis(4-fluorophenyl)methyl)-1-piperazinyl)-N,N'-di-2-propenyl-1,3,5-triazine-2,4-diamine dimethanesulfonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5473183 | Beilstein |
| CAS:29608-49-9 | KEGG DRUG |
| CAS:29608-49-9 | ChemIDplus |
| Citations |
|---|