EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29F2N7 |
| Net Charge | 0 |
| Average Mass | 477.563 |
| Monoisotopic Mass | 477.24525 |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C26H29F2N7/c1-3-13-29-24-31-25(30-14-4-2)33-26(32-24)35-17-15-34(16-18-35)23(19-5-9-21(27)10-6-19)20-7-11-22(28)12-8-20/h3-12,23H,1-2,13-18H2,(H2,29,30,31,32,33) |
| InChIKey | OBDOVFRMEYHSQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| almitrine (CHEBI:53778) has role central nervous system stimulant (CHEBI:35337) |
| almitrine (CHEBI:53778) is a piperazines (CHEBI:26144) |
| almitrine (CHEBI:53778) is a triamino-1,3,5-triazine (CHEBI:38175) |
| Incoming Relation(s) |
| almitrine dimesylate (CHEBI:53779) has part almitrine (CHEBI:53778) |
| IUPAC Name |
|---|
| N,N'-diallyl-6-{4-[bis(4-fluorophenyl)methyl]piperazin-1-yl}-1,3,5-triazine-2,4-diamine |
| INNs | Source |
|---|---|
| almitrine | KEGG DRUG |
| almitrina | ChemIDplus |
| almitrinum | ChemIDplus |
| Synonym | Source |
|---|---|
| 2,4-Bis(allylamino)-6-(4-(bis(p-fluorophenyl)methyl)-1-piperazinyl)-s-triazine | ChEBI |