EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29ClO5 |
| Net Charge | 0 |
| Average Mass | 408.922 |
| Monoisotopic Mass | 408.17035 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])[C@H](Cl)CC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H29ClO5/c1-11-6-14-18-15(23)8-12-7-13(25)4-5-20(12,2)19(18)16(26)9-21(14,3)22(11,28)17(27)10-24/h4-5,7,11,14-16,18-19,24,26,28H,6,8-10H2,1-3H3/t11-,14+,15-,16+,18-,19+,20+,21+,22+/m1/s1 |
| InChIKey | FJXOGVLKCZQRDN-PHCHRAKRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alclometasone (CHEBI:53776) has functional parent prednisolone (CHEBI:8378) |
| alclometasone (CHEBI:53776) has role anti-inflammatory drug (CHEBI:35472) |
| alclometasone (CHEBI:53776) has role antipruritic drug (CHEBI:59683) |
| alclometasone (CHEBI:53776) is a 11β-hydroxy steroid (CHEBI:35346) |
| alclometasone (CHEBI:53776) is a 17α-hydroxy steroid (CHEBI:35342) |
| alclometasone (CHEBI:53776) is a 20-oxo steroid (CHEBI:36885) |
| alclometasone (CHEBI:53776) is a 21-hydroxy steroid (CHEBI:35344) |
| alclometasone (CHEBI:53776) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| alclometasone (CHEBI:53776) is a chlorinated steroid (CHEBI:77175) |
| alclometasone (CHEBI:53776) is a glucocorticoid (CHEBI:24261) |
| alclometasone (CHEBI:53776) is a primary α-hydroxy ketone (CHEBI:139590) |
| alclometasone (CHEBI:53776) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (7α,11β,16α)-7-chloro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione |
| INN | Source |
|---|---|
| alclometasone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 7α-Chloro-16α-methylprednisolone | ChemIDplus |
| Aclometasone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Alclometasone | Wikipedia |
| D07116 | KEGG DRUG |
| DB00240 | DrugBank |
| US4076708 | Patent |
| US4124707 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6439798 | Beilstein |
| CAS:67452-97-5 | ChemIDplus |
| CAS:67452-97-5 | KEGG DRUG |