EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2OS |
| Net Charge | 0 |
| Average Mass | 326.465 |
| Monoisotopic Mass | 326.14528 |
| SMILES | CC(=O)c1ccc2c(c1)N(C[C@@H](C)N(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | XLOQNFNTQIRSOX-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-aceprometazine (CHEBI:53771) is a aceprometazine (CHEBI:53770) |
| (R)-aceprometazine (CHEBI:53771) is enantiomer of (S)-aceprometazine (CHEBI:53772) |
| Incoming Relation(s) |
| (S)-aceprometazine (CHEBI:53772) is enantiomer of (R)-aceprometazine (CHEBI:53771) |
| IUPAC Name |
|---|
| 1-{10-[(2R)-2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone |