EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2OS |
| Net Charge | 0 |
| Average Mass | 326.465 |
| Monoisotopic Mass | 326.14528 |
| SMILES | CC(=O)c1ccc2c(c1)N(CC(C)N(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 |
| InChIKey | XLOQNFNTQIRSOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aceprometazine (CHEBI:53770) has role anxiolytic drug (CHEBI:35474) |
| aceprometazine (CHEBI:53770) has role histamine antagonist (CHEBI:37956) |
| aceprometazine (CHEBI:53770) has role sedative (CHEBI:35717) |
| aceprometazine (CHEBI:53770) is a aromatic ketone (CHEBI:76224) |
| aceprometazine (CHEBI:53770) is a methyl ketone (CHEBI:51867) |
| aceprometazine (CHEBI:53770) is a phenothiazines (CHEBI:38093) |
| aceprometazine (CHEBI:53770) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| (R)-aceprometazine (CHEBI:53771) is a aceprometazine (CHEBI:53770) |
| (S)-aceprometazine (CHEBI:53772) is a aceprometazine (CHEBI:53770) |
| IUPAC Name |
|---|
| 1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone |
| INNs | Source |
|---|---|
| aceprometazine | DrugBank |
| aceprometazina | DrugBank |
| aceprometazinum | DrugBank |
| acéprométazine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10-(2-(Dimethylamino)propyl)phenothiazin-2-yl methyl ketone | ChEBI |
| Acepromethazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB01615 | DrugBank |
| Aceprometazine | Wikipedia |
| 50 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:38528 | Reaxys |
| CAS:13461-01-3 | DrugBank |
| CAS:13461-01-3 | ChemIDplus |
| CAS:13461-01-3 | NIST Chemistry WebBook |