EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20FN5O4.CH4O3S |
| Net Charge | 0 |
| Average Mass | 485.494 |
| Monoisotopic Mass | 485.13805 |
| SMILES | CO/N=C1\CN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1CN.CS(=O)(=O)O |
| InChI | InChI=1S/C18H20FN5O4.CH4O3S/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17;1-5(2,3)4/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27);1H3,(H,2,3,4)/b22-14+; |
| InChIKey | JIYMVSQRGZEYAX-CWUUNJJBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gemifloxacin mesylate (CHEBI:53749) has part gemifloxacin (CHEBI:101853) |
| gemifloxacin mesylate (CHEBI:53749) has role antimicrobial agent (CHEBI:33281) |
| gemifloxacin mesylate (CHEBI:53749) has role topoisomerase IV inhibitor (CHEBI:53559) |
| gemifloxacin mesylate (CHEBI:53749) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 7-[3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid methanesulfonate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9176911 | Beilstein |
| CAS:210353-53-0 | KEGG DRUG |
| CAS:210353-53-0 | ChemIDplus |