EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20FN5O4 |
| Net Charge | 0 |
| Average Mass | 389.387 |
| Monoisotopic Mass | 389.14993 |
| SMILES | CO/N=C1\CN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1CN |
| InChI | InChI=1S/C18H20FN5O4/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27)/b22-14+ |
| InChIKey | ZRCVYEYHRGVLOC-HYARGMPZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gemifloxacin (CHEBI:101853) has role antibacterial drug (CHEBI:36047) |
| gemifloxacin (CHEBI:101853) has role antimicrobial agent (CHEBI:33281) |
| gemifloxacin (CHEBI:101853) has role topoisomerase IV inhibitor (CHEBI:53559) |
| gemifloxacin (CHEBI:101853) is a 1,8-naphthyridine derivative (CHEBI:73537) |
| gemifloxacin (CHEBI:101853) is a fluoroquinolone antibiotic (CHEBI:87211) |
| gemifloxacin (CHEBI:101853) is a monocarboxylic acid (CHEBI:25384) |
| gemifloxacin (CHEBI:101853) is a quinolone antibiotic (CHEBI:86324) |
| Incoming Relation(s) |
| gemifloxacin mesylate (CHEBI:53749) has part gemifloxacin (CHEBI:101853) |
| IUPAC Name |
|---|
| 7-[3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| INN | Source |
|---|---|
| gemifloxacin | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8361408 | Beilstein |
| CAS:175463-14-6 | DrugBank |
| CAS:175463-14-6 | ChemIDplus |