EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3N3O2 |
| Net Charge | 0 |
| Average Mass | 113.076 |
| Monoisotopic Mass | 113.02253 |
| SMILES | O=c1cnnc(=O)n1 |
| InChI | InChI=1S/C3H3N3O2/c7-2-1-4-6-3(8)5-2/h1H,(H2,5,6,7,8) |
| InChIKey | SSPYSWLZOPCOLO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-azauracil (CHEBI:53745) has role antimetabolite (CHEBI:35221) |
| 6-azauracil (CHEBI:53745) is a 1,2,4-triazines (CHEBI:39410) |
| 6-azauracil (CHEBI:53745) is a nucleobase analogue (CHEBI:67142) |
| IUPAC Name |
|---|
| 1,2,4-triazine-3,5(2H,4H)-dione |
| Synonyms | Source |
|---|---|
| 1,2,4-Triazine-3,5(2H,4H)-dione | ChemIDplus |
| 1,2,4-Triazine-3,5-diol | ChemIDplus |
| 4(6)-Azauracil | ChemIDplus |
| as-Triazine-3,5(2H,4H)-dione | ChemIDplus |
| as-Triazine-3,5-diol | ChemIDplus |
| Azauracil | ChemIDplus |