EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO4 |
| Net Charge | 0 |
| Average Mass | 355.434 |
| Monoisotopic Mass | 355.17836 |
| SMILES | [H][C@]12Cc3cc(OC)c(OC)cc3-c3c(OC)c(OC)cc(c31)CCN2C |
| InChI | InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/t15-/m0/s1 |
| InChIKey | RUZIUYOSRDWYQF-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis turtschaninovii (ncbitaxon:1577077) | |||
| tuber (BTO:0001400) | PubMed (25670016) | ||
| rhizome (BTO:0001181) | PubMed (25277281) | ||
| Corydalis yanhusuo (ncbitaxon:458692) | - | PubMed (23194502) | |
| Glaucium flavum (ncbitaxon:56853) | root (BTO:0001188) | PubMed (24317429) | |
| Nandina domestica (ncbitaxon:41776) | fruit (BTO:0000486) | PubMed (24897106) | |
| Xylopia laevigata (IPNI:269802-2) | stem (BTO:0001300) | PubMed (27399666) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-glaucine (CHEBI:5373) has role antibacterial agent (CHEBI:33282) |
| (S)-glaucine (CHEBI:5373) has role antineoplastic agent (CHEBI:35610) |
| (S)-glaucine (CHEBI:5373) has role antitussive (CHEBI:51177) |
| (S)-glaucine (CHEBI:5373) has role muscle relaxant (CHEBI:51371) |
| (S)-glaucine (CHEBI:5373) has role NF-κB inhibitor (CHEBI:73240) |
| (S)-glaucine (CHEBI:5373) has role plant metabolite (CHEBI:76924) |
| (S)-glaucine (CHEBI:5373) has role platelet aggregation inhibitor (CHEBI:50427) |
| (S)-glaucine (CHEBI:5373) has role rat metabolite (CHEBI:86264) |
| (S)-glaucine (CHEBI:5373) is a aporphine alkaloid (CHEBI:134209) |
| (S)-glaucine (CHEBI:5373) is a organic heterotetracyclic compound (CHEBI:38163) |
| (S)-glaucine (CHEBI:5373) is a polyether (CHEBI:46774) |
| (S)-glaucine (CHEBI:5373) is a tertiary amino compound (CHEBI:50996) |
| (S)-glaucine (CHEBI:5373) is conjugate base of (S)-glaucine(1+) (CHEBI:134212) |
| Incoming Relation(s) |
| (S)-1,2,9,10-tetramethoxy-6-methylaporphine(1+) (CHEBI:134213) has functional parent (S)-glaucine (CHEBI:5373) |
| (S)-glaucine(1+) (CHEBI:134212) is conjugate acid of (S)-glaucine (CHEBI:5373) |
| IUPAC Name |
|---|
| (6aS)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| Synonyms | Source |
|---|---|
| 1,2,9,10-Tetramethoxy-6a-alpha-aporphine | ChemIDplus |
| Boldine dimethyl ether | ChemIDplus |
| d-Glaucine | ChemIDplus |
| Glaucine | KEGG COMPOUND |
| S-(+)-Glaucine | ChemIDplus |
| Citations |
|---|