EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O3S |
| Net Charge | 0 |
| Average Mass | 280.309 |
| Monoisotopic Mass | 280.06301 |
| SMILES | COc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | GPTONYMQFTZPKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | leprostatic drug A substance that suppresses Mycobacterium leprae, ameliorates the clinical manifestations of leprosy, and/or reduces the incidence and severity of leprous reactions. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | leprostatic drug A substance that suppresses Mycobacterium leprae, ameliorates the clinical manifestations of leprosy, and/or reduces the incidence and severity of leprous reactions. renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethoxydiazine (CHEBI:53727) has functional parent sulfanilamide (CHEBI:45373) |
| sulfamethoxydiazine (CHEBI:53727) has role antiinfective agent (CHEBI:35441) |
| sulfamethoxydiazine (CHEBI:53727) has role leprostatic drug (CHEBI:35816) |
| sulfamethoxydiazine (CHEBI:53727) has role renal agent (CHEBI:35846) |
| sulfamethoxydiazine (CHEBI:53727) is a pyrimidines (CHEBI:39447) |
| sulfamethoxydiazine (CHEBI:53727) is a sulfonamide (CHEBI:35358) |
| sulfamethoxydiazine (CHEBI:53727) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfametoxidiazina | ChemIDplus |
| sulfametoxydiazine | KEGG DRUG |
| sulfametoxydiazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-Aminobenzenesulfonamido)-5-methoxypyrimidine | ChemIDplus |
| 2-Sulfanilamido-5-methoxypyrimidin | ChemIDplus |
| 2-Sulfanilamido-5-methoxypyrimidine | ChemIDplus |
| 4-Amino-N-(5-methoxy-2-pyrimidinyl)benzenesulfonamide | ChemIDplus |
| 5-Methoxy-2-sulfanilamidopyrimidine | ChemIDplus |
| 5-Methoxysulfadiazine | NIST Chemistry WebBook |
| Citations |
|---|