EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl2O3 |
| Net Charge | -1 |
| Average Mass | 206.004 |
| Monoisotopic Mass | 204.94647 |
| SMILES | O=C([O-])c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12)/p-1 |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dichloro-4-hydroxybenzoate (CHEBI:53686) has functional parent benzoate (CHEBI:16150) |
| 3,5-dichloro-4-hydroxybenzoate (CHEBI:53686) is a monohydroxybenzoate (CHEBI:25388) |
| 3,5-dichloro-4-hydroxybenzoate (CHEBI:53686) is conjugate base of 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) |
| Incoming Relation(s) |
| 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) is conjugate acid of 3,5-dichloro-4-hydroxybenzoate (CHEBI:53686) |
| IUPAC Name |
|---|
| 3,5-dichloro-4-hydroxybenzoate |