EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4Cl2O3 |
| Net Charge | 0 |
| Average Mass | 207.012 |
| Monoisotopic Mass | 205.95375 |
| SMILES | O=C(O)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) has functional parent 4-hydroxybenzoic acid (CHEBI:30763) |
| 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) has functional parent benzoic acid (CHEBI:30746) |
| 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) is a dichlorobenzene (CHEBI:23697) |
| 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) is conjugate acid of 3,5-dichloro-4-hydroxybenzoate (CHEBI:53686) |
| Incoming Relation(s) |
| 3,5-dichloro-4-hydroxybenzoate (CHEBI:53686) is conjugate base of 3,5-dichloro-4-hydroxybenzoic acid (CHEBI:53685) |
| IUPAC Name |
|---|
| 3,5-dichloro-4-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| DiClHBz | ChEBI |
| 3,5-dichloro-p-salicylic acid | ChEBI |
| Citations |
|---|