EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClNO3 |
| Net Charge | 0 |
| Average Mass | 215.636 |
| Monoisotopic Mass | 215.03492 |
| SMILES | N[C@@H](Cc1ccc(O)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | ACWBBAGYTKWBCD-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (9151778) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-L-tyrosine (CHEBI:53678) has role biomarker (CHEBI:59163) |
| 3-chloro-L-tyrosine (CHEBI:53678) has role human metabolite (CHEBI:77746) |
| 3-chloro-L-tyrosine (CHEBI:53678) is a L-tyrosine derivative (CHEBI:27177) |
| 3-chloro-L-tyrosine (CHEBI:53678) is a chloroamino acid (CHEBI:23129) |
| 3-chloro-L-tyrosine (CHEBI:53678) is a monochlorobenzenes (CHEBI:83403) |
| 3-chloro-L-tyrosine (CHEBI:53678) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-chloro-L-tyrosine (CHEBI:53678) is tautomer of 3-chloro-L-tyrosine zwitterion (CHEBI:189422) |
| Incoming Relation(s) |
| 3-chloro-L-tyrosine zwitterion (CHEBI:189422) is tautomer of 3-chloro-L-tyrosine (CHEBI:53678) |
| IUPAC Name |
|---|
| 3-chloro-L-tyrosine |
| Synonyms | Source |
|---|---|
| 3-chlorotyrosine | ChEBI |
| ClY | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001885 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2941263 | Reaxys |
| CAS:7423-93-0 | ChemIDplus |
| Citations |
|---|