EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClNO3 |
| Net Charge | 0 |
| Average Mass | 215.636 |
| Monoisotopic Mass | 215.03492 |
| SMILES | [NH3+][C@@H](Cc1ccc(O)c(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | ACWBBAGYTKWBCD-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-L-tyrosine zwitterion (CHEBI:189422) is a L-α-amino acid zwitterion (CHEBI:59869) |
| 3-chloro-L-tyrosine zwitterion (CHEBI:189422) is tautomer of 3-chloro-L-tyrosine (CHEBI:53678) |
| Incoming Relation(s) |
| 3-chloro-L-tyrosine (CHEBI:53678) is tautomer of 3-chloro-L-tyrosine zwitterion (CHEBI:189422) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(3-chloro-4-hydroxyphenyl)propanoate |
| Synonyms | Source |
|---|---|
| 3-chloro-L-Tyr zwitterion | SUBMITTER |
| (2S)-2-ammonio-3-(3-chloro-4-hydroxyphenyl)propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-chloro-L-tyrosine | UniProt |
| Citations |
|---|