EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N3O5S |
| Net Charge | -1 |
| Average Mass | 362.387 |
| Monoisotopic Mass | 362.08162 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H17N3O5S/c1-7-6-25-15-11(14(22)19(15)12(7)16(23)24)18-13(21)10(17)8-2-4-9(20)5-3-8/h2-5,10-11,15,20H,6,17H2,1H3,(H,18,21)(H,23,24)/p-1/t10-,11-,15-/m1/s1 |
| InChIKey | BOEGTKLJZSQCCD-UEKVPHQBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefadroxil(1−) (CHEBI:53669) is a cephalosporin carboxylic acid anion (CHEBI:52440) |
| cefadroxil(1−) (CHEBI:53669) is conjugate base of cefadroxil (CHEBI:3479) |
| Incoming Relation(s) |
| cefadroxil (CHEBI:3479) is conjugate acid of cefadroxil(1−) (CHEBI:53669) |
| IUPAC Name |
|---|
| 7β-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,4-didehydrocepham-4-carboxylate |
| Synonym | Source |
|---|---|
| (6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |