EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4N2O7 |
| Net Charge | 0 |
| Average Mass | 228.116 |
| Monoisotopic Mass | 228.00185 |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C7H4N2O7/c10-6-4(7(11)12)1-3(8(13)14)2-5(6)9(15)16/h1-2,10H,(H,11,12) |
| InChIKey | LWFUFLREGJMOIZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dinitrosalicylic acid (CHEBI:53648) has functional parent salicylic acid (CHEBI:16914) |
| 3,5-dinitrosalicylic acid (CHEBI:53648) has role hapten (CHEBI:59174) |
| 3,5-dinitrosalicylic acid (CHEBI:53648) is a C-nitro compound (CHEBI:35716) |
| 3,5-dinitrosalicylic acid (CHEBI:53648) is a monohydroxybenzoic acid (CHEBI:25389) |
| Incoming Relation(s) |
| 3,5-dinitrosalicylic acid hydrazide (CHEBI:189548) has functional parent 3,5-dinitrosalicylic acid (CHEBI:53648) |
| IUPAC Name |
|---|
| 2-hydroxy-3,5-dinitrobenzoic acid |
| Synonyms | Source |
|---|---|
| 3,5-Dinitro-2-hydroxybenzoic acid | ChemIDplus |
| 3,5-dinitro-2-salicylic acid | ChEBI |
| 3,5-Dinitrosalicylate | ChemIDplus |
| 3,5-Dinitrosalicylic acid | KEGG COMPOUND |
| DNS | ChEBI |
| DNSA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3,5-Dinitrosalicylic acid | Wikipedia |
| C11319 | KEGG COMPOUND |
| Citations |
|---|