EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4ClNOS |
| Net Charge | 0 |
| Average Mass | 149.602 |
| Monoisotopic Mass | 148.97021 |
| SMILES | Cn1sc(Cl)cc1=O |
| InChI | InChI=1S/C4H4ClNOS/c1-6-4(7)2-3(5)8-6/h2H,1H3 |
| InChIKey | DHNRXBZYEKSXIM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloromethylisothiazolinone (CHEBI:53621) has functional parent methylisothiazolinone (CHEBI:53620) |
| chloromethylisothiazolinone (CHEBI:53621) has role antimicrobial agent (CHEBI:33281) |
| chloromethylisothiazolinone (CHEBI:53621) has role environmental contaminant (CHEBI:78298) |
| chloromethylisothiazolinone (CHEBI:53621) has role xenobiotic (CHEBI:35703) |
| chloromethylisothiazolinone (CHEBI:53621) is a 1,2-thiazoles (CHEBI:48902) |
| chloromethylisothiazolinone (CHEBI:53621) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| MCI/MI (CHEBI:63556) has part chloromethylisothiazolinone (CHEBI:53621) |
| IUPAC Name |
|---|
| 5-chloro-2-methyl-1,2-thiazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 2,3-dihydro-2-methyl-3-oxo-5-chloroisothiazole | NIST Chemistry WebBook |
| 5-chloro-2-methyl-2H-isothiazol-3-one | NIST Chemistry WebBook |
| 5-Chloro-2-methyl-4-isothiazolin-3-one | ChemIDplus |
| CMIT | ChEBI |
| MCI | ChEBI |
| methylchloroisothiazolinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Methylchloroisothiazolinone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1210149 | Reaxys |
| CAS:26172-55-4 | NIST Chemistry WebBook |
| CAS:26172-55-4 | ChemIDplus |
| Citations |
|---|