EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5NOS |
| Net Charge | 0 |
| Average Mass | 115.157 |
| Monoisotopic Mass | 115.00918 |
| SMILES | Cn1sccc1=O |
| InChI | InChI=1S/C4H5NOS/c1-5-4(6)2-3-7-5/h2-3H,1H3 |
| InChIKey | BEGLCMHJXHIJLR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylisothiazolinone (CHEBI:53620) has role antifouling biocide (CHEBI:51076) |
| methylisothiazolinone (CHEBI:53620) has role antifungal agent (CHEBI:35718) |
| methylisothiazolinone (CHEBI:53620) has role antimicrobial agent (CHEBI:33281) |
| methylisothiazolinone (CHEBI:53620) is a 1,2-thiazoles (CHEBI:48902) |
| Incoming Relation(s) |
| chloromethylisothiazolinone (CHEBI:53621) has functional parent methylisothiazolinone (CHEBI:53620) |
| MCI/MI (CHEBI:63556) has part methylisothiazolinone (CHEBI:53620) |
| IUPAC Name |
|---|
| 2-methyl-1,2-thiazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 2-Methyl-3(2H)-isothiazolone | ChemIDplus |
| 2-Methyl-4-isothiazolin-3-one | ChemIDplus |
| MI | ChEBI |
| MIT | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP2289335 | Patent |
| Methylisothiazolinone | Wikipedia |
| Citations |
|---|