EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5NOS |
| Net Charge | 0 |
| Average Mass | 115.157 |
| Monoisotopic Mass | 115.00918 |
| SMILES | Cn1sccc1=O |
| InChI | InChI=1S/C4H5NOS/c1-5-4(6)2-3-7-5/h2-3H,1H3 |
| InChIKey | BEGLCMHJXHIJLR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylisothiazolinone (CHEBI:53620) has role antifouling biocide (CHEBI:51076) |
| methylisothiazolinone (CHEBI:53620) has role antifungal agent (CHEBI:35718) |
| methylisothiazolinone (CHEBI:53620) has role antimicrobial agent (CHEBI:33281) |
| methylisothiazolinone (CHEBI:53620) is a 1,2-thiazoles (CHEBI:48902) |
| Incoming Relation(s) |
| chloromethylisothiazolinone (CHEBI:53621) has functional parent methylisothiazolinone (CHEBI:53620) |
| MCI/MI (CHEBI:63556) has part methylisothiazolinone (CHEBI:53620) |
| IUPAC Name |
|---|
| 2-methyl-1,2-thiazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 2-Methyl-3(2H)-isothiazolone | ChemIDplus |
| 2-Methyl-4-isothiazolin-3-one | ChemIDplus |
| MI | ChEBI |
| MIT | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP2289335 | Patent |
| Methylisothiazolinone | Wikipedia |
| Citations |
|---|