EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O10 |
| Net Charge | 0 |
| Average Mass | 424.402 |
| Monoisotopic Mass | 424.13695 |
| SMILES | [H][C@@]1(C(C)(C)C)[C@@H](O)[C@@]2([H])OC(=O)[C@@]34O[C@@H]5OC(=O)[C@H](O)C51C32C[C@]1([H])OC(=O)[C@@H](C)[C@]41O |
| InChI | InChI=1S/C20H24O10/c1-6-12(23)27-7-5-17-11-8(21)9(16(2,3)4)18(17)10(22)13(24)29-15(18)30-20(17,14(25)28-11)19(6,7)26/h6-11,15,21-22,26H,5H2,1-4H3/t6-,7+,8-,9+,10+,11-,15+,17?,18?,19-,20-/m1/s1 |
| InChIKey | LMEHVEUFNRJAAV-OODNYQCMSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ginkgolide J (CHEBI:5358) is a diterpene lactone (CHEBI:49193) |
| Ginkgolide J (CHEBI:5358) is a ginkgolide (CHEBI:136909) |
| Synonyms | Source |
|---|---|
| BN 52024 | KEGG COMPOUND |
| Ginkgolide J | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07604 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:107438-79-9 | KEGG COMPOUND |