EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O10 |
| Net Charge | 0 |
| Average Mass | 424.402 |
| Monoisotopic Mass | 424.13695 |
| SMILES | [H][C@@]1(C(C)(C)C)C[C@@]2([H])OC(=O)[C@@]34O[C@@H]5OC(=O)[C@H](O)C51C23[C@@H](O)[C@]1([H])OC(=O)[C@@H](C)[C@@]14O |
| InChI | InChI=1S/C20H24O10/c1-6-12(23)28-11-9(21)18-8-5-7(16(2,3)4)17(18)10(22)13(24)29-15(17)30-20(18,14(25)27-8)19(6,11)26/h6-11,15,21-22,26H,5H2,1-4H3/t6-,7+,8-,9+,10+,11+,15+,17?,18?,19-,20-/m1/s1 |
| InChIKey | SQOJOAFXDQDRGF-NNGCZKEZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ginkgo biloba (ncbitaxon:3311) | root (BTO:0001188) | PubMed (15038029) | Isolated from root bark |
| Roles Classification |
|---|
| Biological Roles: | platelet-activating factor receptor antagonist An antagonist that acts at the platelet-activating factor receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginkgolide B (CHEBI:5356) has role antineoplastic agent (CHEBI:35610) |
| ginkgolide B (CHEBI:5356) has role neuroprotective agent (CHEBI:63726) |
| ginkgolide B (CHEBI:5356) has role platelet-activating factor receptor antagonist (CHEBI:134182) |
| ginkgolide B (CHEBI:5356) is a diterpene lactone (CHEBI:49193) |
| ginkgolide B (CHEBI:5356) is a ginkgolide (CHEBI:136909) |
| IUPAC Name |
|---|
| (1R,3R,6R,8S,10R,12R,13S,16S,17R)-8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione |
| Manual Xrefs | Databases |
|---|---|
| C00035830 | KNApSAcK |
| C07602 | KEGG COMPOUND |
| DB06744 | DrugBank |
| HMDB0036861 | HMDB |
| LMPR0104540002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4727611 | Reaxys |
| Reaxys:8173450 | Reaxys |
| CAS:15291-77-7 | ChemIDplus |
| CAS:15291-77-7 | KEGG COMPOUND |
| Citations |
|---|