EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C22H23N3O4.Cl |
| Net Charge | 0 |
| Average Mass | 429.904 |
| Monoisotopic Mass | 429.14553 |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.[Cl-].[H+] |
| InChI | InChI=1S/C22H23N3O4.ClH/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22;/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25);1H |
| InChIKey | GTTBEUCJPZQMDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erlotinib hydrochloride (CHEBI:53509) has part erlotinib (CHEBI:114785) |
| erlotinib hydrochloride (CHEBI:53509) has role antineoplastic agent (CHEBI:35610) |
| erlotinib hydrochloride (CHEBI:53509) has role protein kinase inhibitor (CHEBI:37699) |
| erlotinib hydrochloride (CHEBI:53509) is a hydrochloride (CHEBI:36807) |
| erlotinib hydrochloride (CHEBI:53509) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 4-(m-ethynylanilino)-6,7-bis(2-methoxyethoxy)quinazoline monohydrochloride | ChemIDplus |
| erlotinib HCl | ChemIDplus |
| erlotinib hydrochloride | DrugCentral |
| CP 358774 | ChemIDplus |
| OSI-774 | ChemIDplus |
| NSC 718781 | ChEBI |
| Brand Name | Source |
|---|---|
| Tarceva | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D04023 | KEGG DRUG |
| DBSALT000064 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8813963 | Beilstein |
| CAS:183319-69-9 | KEGG DRUG |
| CAS:183319-69-9 | ChemIDplus |
| Citations |
|---|