EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23N3O4 |
| Net Charge | 0 |
| Average Mass | 393.443 |
| Monoisotopic Mass | 393.16886 |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25) |
| InChIKey | AAKJLRGGTJKAMG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erlotinib (CHEBI:114785) has role antineoplastic agent (CHEBI:35610) |
| erlotinib (CHEBI:114785) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| erlotinib (CHEBI:114785) has role protein kinase inhibitor (CHEBI:37699) |
| erlotinib (CHEBI:114785) is a aromatic ether (CHEBI:35618) |
| erlotinib (CHEBI:114785) is a quinazolines (CHEBI:38530) |
| erlotinib (CHEBI:114785) is a secondary amino compound (CHEBI:50995) |
| erlotinib (CHEBI:114785) is a terminal acetylenic compound (CHEBI:73477) |
| Incoming Relation(s) |
| erlotinib hydrochloride (CHEBI:53509) has part erlotinib (CHEBI:114785) |
| IUPAC Name |
|---|
| N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| INNs | Source |
|---|---|
| erlotinib | WHO MedNet |
| erlotinib | WHO MedNet |
| erlotinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| [6,7-bis-(2-methoxy-ethoxy)-quinazolin-4-yl]-(3-ethynyl-phenyl)-amine | DrugBank |
| [6,7-bis(2-methoxy-ethoxy)quinazoline-4-yl]-(3-ethynylphenyl)amine | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 1045 | DrugCentral |
| AQ4 | PDBeChem |
| D07907 | KEGG DRUG |
| DB00530 | DrugBank |
| Erlotinib | Wikipedia |
| HMDB0014671 | HMDB |
| LSM-1097 | LINCS |
| US2010094004 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8798958 | Reaxys |
| CAS:183321-74-6 | ChemIDplus |
| CAS:183321-74-6 | DrugBank |
| CAS:183321-74-6 | KEGG DRUG |
| Citations |
|---|