EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cr2O7.2K |
| Net Charge | 0 |
| Average Mass | 294.181 |
| Monoisotopic Mass | 293.77283 |
| SMILES | [K+].[K+].[O]=[Cr](=[O])([O-])[O][Cr](=[O])(=[O])[O-] |
| InChI | InChI=1S/2Cr.2K.7O/q;;2*+1;;;;;;2*-1 |
| InChIKey | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium dichromate (CHEBI:53444) has part dichromate(2−) (CHEBI:33141) |
| potassium dichromate (CHEBI:53444) has role allergen (CHEBI:50904) |
| potassium dichromate (CHEBI:53444) has role oxidising agent (CHEBI:63248) |
| potassium dichromate (CHEBI:53444) has role sensitiser (CHEBI:139492) |
| potassium dichromate (CHEBI:53444) is a potassium salt (CHEBI:26218) |
| IUPAC Names |
|---|
| dipotassium dichromate |
| potassium dichromate(2−) |
| potassium dichromate(VI) |
| Synonyms | Source |
|---|---|
| Chromium potassium oxide | ChemIDplus |
| Dichromic acid dipotassium salt | ChemIDplus |
| Dipotassium bichromate | ChemIDplus |
| Dipotassium dichromate | ChemIDplus |
| Dipotassium dichromium heptaoxide | ChemIDplus |
| Kaliumdichromat | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C15227 | KEGG COMPOUND |
| Potassium_dichromate | Wikipedia |
| Citations |
|---|