EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H7NO3)n.H2O |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | [H]N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | WHUUTDBJXJRKMK-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-poly(L-glutamic acid) macromolecule (CHEBI:53374) is a γ-poly(glutamic acid) macromolecule (CHEBI:53373) |
| γ-poly(L-glutamic acid) macromolecule (CHEBI:53374) is enantiomer of γ-poly(D-glutamic acid) macromolecule (CHEBI:53375) |
| Incoming Relation(s) |
| γ-poly(L-glutamic acid) polymer (CHEBI:60533) has part γ-poly(L-glutamic acid) macromolecule (CHEBI:53374) |
| γ-poly(D-glutamic acid) macromolecule (CHEBI:53375) is enantiomer of γ-poly(L-glutamic acid) macromolecule (CHEBI:53374) |
| Synonyms | Source |
|---|---|
| alpha-L-Glutamic acid polymer | ChemIDplus |
| Glutamic acid polymer | ChemIDplus |
| PLGA | SUBMITTER |
| Poly(alpha-L-glutamic acid) | ChemIDplus |
| Polyglutamic acid | ChemIDplus |
| Poly-L-glutamate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:25513-46-6 | ChemIDplus |