EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53373 - γ-poly(glutamic acid) macromolecule
| Formula | (C5H7NO3)n.H2O |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | [H]NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | WHUUTDBJXJRKMK-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-poly(glutamic acid) macromolecule (CHEBI:53373) is a homopolymer macromolecule (CHEBI:37997) |
| γ-poly(glutamic acid) macromolecule (CHEBI:53373) is a poly(amide) macromolecule (CHEBI:53224) |
| γ-poly(glutamic acid) macromolecule (CHEBI:53373) is conjugate acid of γ-poly(glutamate) macromolecule (CHEBI:53376) |
| Incoming Relation(s) |
| γ-poly(glutamic acid) polymer (CHEBI:60526) has part γ-poly(glutamic acid) macromolecule (CHEBI:53373) |
| γ-poly(D-glutamic acid) macromolecule (CHEBI:53375) is a γ-poly(glutamic acid) macromolecule (CHEBI:53373) |
| γ-poly(L-glutamic acid) macromolecule (CHEBI:53374) is a γ-poly(glutamic acid) macromolecule (CHEBI:53373) |
| γ-poly(glutamate) macromolecule (CHEBI:53376) is conjugate base of γ-poly(glutamic acid) macromolecule (CHEBI:53373) |
| Synonyms | Source |
|---|---|
| poly(glutamicacid) | SUBMITTER |
| polyglutamicacid | SUBMITTER |
| polyglutamic acid | SUBMITTER |
| PLG | SUBMITTER |
| poly(glutamic acid) | ChEBI |
| γ-poly(glutamic acid) | ChEBI |