EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O4S |
| Net Charge | 0 |
| Average Mass | 292.316 |
| Monoisotopic Mass | 292.05178 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C13H12N2O4S/c14-10-3-7-12(8-4-10)20(18,19)15-11-5-1-9(2-6-11)13(16)17/h1-8,15H,14H2,(H,16,17) |
| InChIKey | WNLOVPITXSWKEZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-sulfanilamidobenzoic acid (CHEBI:53237) has functional parent sulfanilamide (CHEBI:45373) |
| 4-sulfanilamidobenzoic acid (CHEBI:53237) has role allergen (CHEBI:50904) |
| 4-sulfanilamidobenzoic acid (CHEBI:53237) is a benzoic acids (CHEBI:22723) |
| 4-sulfanilamidobenzoic acid (CHEBI:53237) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-{[(4-aminophenyl)sulfonyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| 4-(((4-aminophenyl)sulfonyl)amino)benzoic acid | ChemIDplus |
| 4-SABA | ChEBI |
| 4-sulphanilamide benzoic acid | ChEBI |
| 4-sulphanilamidobenzoic acid | ChemIDplus |
| p-sulfanilamidobenzoic acid | ChemIDplus |
| SABA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2664013 | Reaxys |
| CAS:6336-70-5 | ChemIDplus |
| Citations |
|---|