EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15N3O2 |
| Net Charge | 0 |
| Average Mass | 329.359 |
| Monoisotopic Mass | 329.11643 |
| SMILES | O=C1NC(=O)c2cc(Nc3ccccc3)c(Nc3ccccc3)cc21 |
| InChI | InChI=1S/C20H15N3O2/c24-19-15-11-17(21-13-7-3-1-4-8-13)18(12-16(15)20(25)23-19)22-14-9-5-2-6-10-14/h1-12,21-22H,(H,23,24,25) |
| InChIKey | AAALVYBICLMAMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dianilinophthalimide (CHEBI:53110) has role geroprotector (CHEBI:176497) |
| 4,5-dianilinophthalimide (CHEBI:53110) has role tyrosine kinase inhibitor (CHEBI:38637) |
| 4,5-dianilinophthalimide (CHEBI:53110) is a phthalimides (CHEBI:82851) |
| IUPAC Name |
|---|
| 5,6-bis(phenylamino)-1H-isoindole-1,3(2H)-dione |
| Synonyms | Source |
|---|---|
| Cgp 52411 | ChemIDplus |
| DAPH | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8134396 | Beilstein |
| CAS:145915-58-8 | ChemIDplus |
| Citations |
|---|