EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O10/c22-6-13-17(27)18(28)19(29)21(31-13)15-12(25)5-11(24)14-16(26)10(7-30-20(14)15)8-1-3-9(23)4-2-8/h1-5,7,13,17-19,21-25,27-29H,6H2/t13-,17-,18+,19-,21+/m1/s1 |
| InChIKey | HIWJJOYYZFELEZ-FFYOZGDPSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| genistein 8-C-glucoside (CHEBI:5304) has functional parent genistein (CHEBI:28088) |
| genistein 8-C-glucoside (CHEBI:5304) has role plant metabolite (CHEBI:76924) |
| genistein 8-C-glucoside (CHEBI:5304) is a C-glycosyl compound (CHEBI:20857) |
| genistein 8-C-glucoside (CHEBI:5304) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[5,7-dihydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]-D-glucitol |
| Manual Xrefs | Databases |
|---|---|
| C00006118 | KNApSAcK |
| C10420 | KEGG COMPOUND |
| LMPK12050163 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5180823 | Reaxys |
| CAS:66026-80-0 | KEGG COMPOUND |
| Citations |
|---|