EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 335.190 |
| Monoisotopic Mass | 334.02758 |
| SMILES | CN1C(=O)C(O)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H12Cl2N2O2/c1-20-13-7-6-9(17)8-11(13)14(19-15(21)16(20)22)10-4-2-3-5-12(10)18/h2-8,15,21H,1H3 |
| InChIKey | FJIKWRGCXUCUIG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lormetazepam (CHEBI:52993) has role sedative (CHEBI:35717) |
| lormetazepam (CHEBI:52993) is a 1,4-benzodiazepinone (CHEBI:35500) |
| lormetazepam (CHEBI:52993) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| INN | Source |
|---|---|
| lormetazepamum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Lormetazepam | KEGG DRUG |
| 7-Chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one | ChemIDplus |
| Methyllorazepam | ChemIDplus |
| N-Methyllorazepam | ChemIDplus |
| Lorazepam | DrugBank |
| (±)-Lorazepam | DrugBank |
| Brand Name | Source |
|---|---|
| Loramet (TN) | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01657 | KEGG DRUG |
| DB00186 | DrugBank |
| BE621819 | Patent |
| US3296249 | Patent |
| Lormetazepam | Wikipedia |
| HMDB0041919 | HMDB |
| 1608 | DrugCentral |
| Citations |
|---|