EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H50O2 |
| Net Charge | 0 |
| Average Mass | 394.684 |
| Monoisotopic Mass | 394.38108 |
| SMILES | [H]C(CCCCCCCCCCCCCCCCCCCCCCC)=C([H])C(=O)O |
| InChI | InChI=1S/C26H50O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h24-25H,2-23H2,1H3,(H,27,28) |
| InChIKey | HMFPLNNQWZGXAH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hexacosenoic acid (CHEBI:52985) is a hexacosenoic acid (CHEBI:78865) |
| 2-hexacosenoic acid (CHEBI:52985) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| cis-2-hexacosenoic acid (CHEBI:52986) is a 2-hexacosenoic acid (CHEBI:52985) |
| trans-2-hexacosenoic acid (CHEBI:52984) is a 2-hexacosenoic acid (CHEBI:52985) |
| IUPAC Name |
|---|
| hexacos-2-enoic acid |
| Synonyms | Source |
|---|---|
| 1-Hexacosenoic acid | ChemIDplus |
| Hexacosenoic acid | ChemIDplus |
| 26:1, n-24 | ChEBI |
| C26:1, n-24 | ChEBI |
| Hexacosensäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:26444-07-5 | ChemIDplus |