EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H31N2O5 |
| Net Charge | +1 |
| Average Mass | 511.598 |
| Monoisotopic Mass | 511.22275 |
| SMILES | CCN1CCCc2cc3c(cc21)Oc1cc2c(cc1=C3c1ccc(C(=O)O)cc1C(=O)O)CCC[N+]=2CC |
| InChI | InChI=1S/C31H30N2O5/c1-3-32-11-5-7-18-13-23-27(16-25(18)32)38-28-17-26-19(8-6-12-33(26)4-2)14-24(28)29(23)21-10-9-20(30(34)35)15-22(21)31(36)37/h9-10,13-17H,3-8,11-12H2,1-2H3,(H-,34,35,36,37)/p+1 |
| InChIKey | JSUSGWOUEVOMBB-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 565 meta-isomer(1+) (CHEBI:52796) has role fluorochrome (CHEBI:51217) |
| ATTO 565 meta-isomer(1+) (CHEBI:52796) is a dicarboxylic acid (CHEBI:35692) |
| ATTO 565 meta-isomer(1+) (CHEBI:52796) is a organic heteropentacyclic compound (CHEBI:38164) |
| ATTO 565 meta-isomer(1+) (CHEBI:52796) is a xanthene dye (CHEBI:37929) |
| Incoming Relation(s) |
| ATTO 565 meta-isomer (CHEBI:51816) has part ATTO 565 meta-isomer(1+) (CHEBI:52796) |
| IUPAC Name |
|---|
| 6-(2,4-dicarboxyphenyl)-1,11-diethyl-3,4,8,9,10,11-hexahydro-2H-pyrano[3,2-g:5,6-g']diquinolin-1-ium |