EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H31N2O5.ClO4 |
| Net Charge | 0 |
| Average Mass | 611.047 |
| Monoisotopic Mass | 610.17181 |
| SMILES | CCN1CCCc2cc3c(cc21)Oc1cc2c(cc1=C3c1ccc(C(=O)O)cc1C(=O)O)CCC[N+]=2CC.O=Cl(=O)(=O)[O-] |
| InChI | InChI=1S/C31H30N2O5.ClHO4/c1-3-32-11-5-7-18-13-23-27(16-25(18)32)38-28-17-26-19(8-6-12-33(26)4-2)14-24(28)29(23)21-10-9-20(30(34)35)15-22(21)31(36)37;2-1(3,4)5/h9-10,13-17H,3-8,11-12H2,1-2H3,(H-,34,35,36,37);(H,2,3,4,5) |
| InChIKey | WPKCJVLZWQTZOT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 565 meta-isomer (CHEBI:51816) has part ATTO 565 meta-isomer(1+) (CHEBI:52796) |
| ATTO 565 meta-isomer (CHEBI:51816) has role fluorochrome (CHEBI:51217) |
| ATTO 565 meta-isomer (CHEBI:51816) is a ATTO 565 (CHEBI:51819) |
| IUPAC Name |
|---|
| 6-(2,4-dicarboxyphenyl)-1,11-diethyl-3,4,8,9,10,11-hexahydro-2H-pyrano[3,2-g:5,6-g']diquinolin-1-ium perchlorate |
| Synonym | Source |
|---|---|
| ATTO 565 free 2,4-dicarboxylic acid | ChEBI |