EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO4 |
| Net Charge | 0 |
| Average Mass | 241.287 |
| Monoisotopic Mass | 241.13141 |
| SMILES | CCC[C@H]1C(=O)N[C@@]2([C@@H](O)C(C)C)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C12H19NO4/c1-4-5-7-9-12(11(16)17-9,13-10(7)15)8(14)6(2)3/h6-9,14H,4-5H2,1-3H3,(H,13,15)/t7-,8+,9+,12-/m1/s1 |
| InChIKey | KMXHEXRPYSXLRN-JDVQERKKSA-N |
| Roles Classification |
|---|
| Application: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS-519 (CHEBI:52724) has functional parent lactacystin (CHEBI:52722) |
| PS-519 (CHEBI:52724) has role proteasome inhibitor (CHEBI:52726) |
| PS-519 (CHEBI:52724) is a lactam (CHEBI:24995) |
| PS-519 (CHEBI:52724) is a β-lactone (CHEBI:49043) |
| IUPAC Name |
|---|
| (1R,4R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-4-propyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8492768 | Beilstein |