EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O7S |
| Net Charge | 0 |
| Average Mass | 376.431 |
| Monoisotopic Mass | 376.13042 |
| SMILES | CC(=O)N[C@@H](CSC(=O)[C@]1([C@@H](O)C(C)C)NC(=O)[C@H](C)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C15H24N2O7S/c1-6(2)10(19)15(11(20)7(3)12(21)17-15)14(24)25-5-9(13(22)23)16-8(4)18/h6-7,9-11,19-20H,5H2,1-4H3,(H,16,18)(H,17,21)(H,22,23)/t7-,9+,10+,11+,15-/m1/s1 |
| InChIKey | DAQAKHDKYAWHCG-RWTHQLGUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lactacystin (CHEBI:52722) is a S-substituted L-cysteine (CHEBI:47910) |
| lactacystin (CHEBI:52722) is a lactam (CHEBI:24995) |
| Incoming Relation(s) |
| PS-519 (CHEBI:52724) has functional parent lactacystin (CHEBI:52722) |
| IUPAC Name |
|---|
| N-acetyl-S-({(2R,3S,4R)-3-hydroxy-2-[(1S)-1-hydroxy-2-methylpropyl]-4-methyl-5-oxopyrrolidin-2-yl}carbonyl)-L-cysteine |
| Registry Numbers | Sources |
|---|---|
| CAS:133343-34-7 | ChemIDplus |