EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O2 |
| Net Charge | 0 |
| Average Mass | 90.122 |
| Monoisotopic Mass | 90.06808 |
| SMILES | CC[C@@H](O)CO |
| InChI | InChI=1S/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | BMRWNKZVCUKKSR-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-butane-1,2-diol (CHEBI:52685) is a butane-1,2-diol (CHEBI:52682) |
| (R)-butane-1,2-diol (CHEBI:52685) is enantiomer of (S)-butane-1,2-diol (CHEBI:52686) |
| Incoming Relation(s) |
| (S)-butane-1,2-diol (CHEBI:52686) is enantiomer of (R)-butane-1,2-diol (CHEBI:52685) |
| IUPAC Name |
|---|
| (2R)-butane-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1718934 | Beilstein |