EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O2 |
| Net Charge | 0 |
| Average Mass | 90.122 |
| Monoisotopic Mass | 90.06808 |
| SMILES | CCC(O)CO |
| InChI | InChI=1S/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
| InChIKey | BMRWNKZVCUKKSR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butane-1,2-diol (CHEBI:52682) has role metabolite (CHEBI:25212) |
| butane-1,2-diol (CHEBI:52682) is a butanediol (CHEBI:52684) |
| butane-1,2-diol (CHEBI:52682) is a glycol (CHEBI:13643) |
| Incoming Relation(s) |
| 1-hydroxybutan-2-one (CHEBI:88390) has functional parent butane-1,2-diol (CHEBI:52682) |
| (R)-butane-1,2-diol (CHEBI:52685) is a butane-1,2-diol (CHEBI:52682) |
| (S)-butane-1,2-diol (CHEBI:52686) is a butane-1,2-diol (CHEBI:52682) |
| IUPAC Name |
|---|
| butane-1,2-diol |
| Synonyms | Source |
|---|---|
| 1,2-Butandiol | NIST Chemistry WebBook |
| 1,2-Butanediol | SUBMITTER |
| 1,2-Butylene glycol | ChemIDplus |
| 1,2-Dihydroxybutane | ChemIDplus |
| 1,2-(Dihydroxy)butane | NIST Chemistry WebBook |
| alpha-Butylene glycol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1,2-Butanediol | Wikipedia |
| CPD-12010 | MetaCyc |
| Citations |
|---|