EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52672 - rhodamine 6G
| Formula | C28H31N2O3.Cl |
| Net Charge | 0 |
| Average Mass | 479.020 |
| Monoisotopic Mass | 478.20232 |
| SMILES | CCNc1cc2[o+]c3cc(NCC)c(C)cc3c(-c3ccccc3C(=O)OCC)c2cc1C.[Cl-] |
| InChI | InChI=1S/C28H31N2O3.ClH/c1-6-29-23-15-25-21(13-17(23)4)27(19-11-9-10-12-20(19)28(31)32-8-3)22-14-18(5)24(30-7-2)16-26(22)33-25;/h9-16,29-30H,6-8H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | XFKVYXCRNATCOO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhodamine 6G (CHEBI:52672) has role fluorochrome (CHEBI:51217) |
| rhodamine 6G (CHEBI:52672) is a organic chloride salt (CHEBI:36094) |
| rhodamine 6G (CHEBI:52672) is a rhodamine 6G(1+) (CHEBI:52895) |
| rhodamine 6G (CHEBI:52672) is a xanthene dye (CHEBI:37929) |
| Incoming Relation(s) |
| 6-carboxyrhodamine 6G (CHEBI:52652) has functional parent rhodamine 6G (CHEBI:52672) |
| IUPAC Name |
|---|
| 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethylxanthenium chloride |
| Synonyms | Source |
|---|---|
| Rhodamine 6G | KEGG COMPOUND |
| 2-(6-(ethylamino)-3-(ethylimino)-2,7-dimethyl-3H-xanthen-9-yl)benzoic acid, ethyl ester, monohydrochloride | ChemIDplus |
| 9-(2-(ethoxycarbonyl)phenyl)-3,6-bis(ethylamino)-2,7-dimethylxanthylium chloride | ChemIDplus |
| Basic Red 1 | ChEBI |
| R6G | ChEBI |