EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31N2O5.Cl |
| Net Charge | 0 |
| Average Mass | 523.029 |
| Monoisotopic Mass | 522.19215 |
| SMILES | CCNc1cc2[o+]c3cc(NCC)c(C)cc3c(-c3cc(C(=O)O)ccc3C(=O)OCC)c2cc1C.[Cl-] |
| InChI | InChI=1S/C29H30N2O5.ClH/c1-6-30-23-14-25-21(11-16(23)4)27(22-12-17(5)24(31-7-2)15-26(22)36-25)20-13-18(28(32)33)9-10-19(20)29(34)35-8-3;/h9-15,30-31H,6-8H2,1-5H3;1H |
| InChIKey | VWOLRKMFAJUZGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-carboxyrhodamine 6G (CHEBI:52652) has functional parent rhodamine 6G (CHEBI:52672) |
| 6-carboxyrhodamine 6G (CHEBI:52652) has role fluorochrome (CHEBI:51217) |
| 6-carboxyrhodamine 6G (CHEBI:52652) is a dicarboxylic acid monoester (CHEBI:36244) |
| 6-carboxyrhodamine 6G (CHEBI:52652) is a ethyl ester (CHEBI:23990) |
| 6-carboxyrhodamine 6G (CHEBI:52652) is a organic chloride salt (CHEBI:36094) |
| 6-carboxyrhodamine 6G (CHEBI:52652) is a xanthene dye (CHEBI:37929) |
| IUPAC Name |
|---|
| 9-[5-carboxy-2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethylxanthenium chloride |
| Synonym | Source |
|---|---|
| 6-CR 6G | ChEBI |