EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O3 |
| Net Charge | 0 |
| Average Mass | 236.271 |
| Monoisotopic Mass | 236.11609 |
| SMILES | CCNC(=O)[C@H](C)OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H16N2O3/c1-3-13-11(15)9(2)17-12(16)14-10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,13,15)(H,14,16)/t9-/m0/s1 |
| InChIKey | AMRQXHFXNZFDCH-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbetamide (CHEBI:3394) has functional parent phenylcarbamic acid (CHEBI:52496) |
| carbetamide (CHEBI:3394) has role environmental contaminant (CHEBI:78298) |
| carbetamide (CHEBI:3394) has role herbicide (CHEBI:24527) |
| carbetamide (CHEBI:3394) has role xenobiotic (CHEBI:35703) |
| carbetamide (CHEBI:3394) is a carbamate ester (CHEBI:23003) |
| carbetamide (CHEBI:3394) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2S)-1-(ethylamino)-1-oxopropan-2-yl phenylcarbamate |
| Manual Xrefs | Databases |
|---|---|
| C11075 | KEGG COMPOUND |
| carbetamide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2983326 | Reaxys |
| CAS:16118-49-3 | KEGG COMPOUND |
| CAS:16118-49-3 | NIST Chemistry WebBook |
| CAS:16118-49-3 | ChemIDplus |
| Citations |
|---|