EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O7S2 |
| Net Charge | -2 |
| Average Mass | 412.445 |
| Monoisotopic Mass | 412.04099 |
| SMILES | [H]C(C(=O)[O-])(C(=O)N[C@]1(OC)C(=O)N2[C@@H](C(=O)[O-])C(C)(C)S[C@@]21[H])c1ccsc1 |
| InChI | InChI=1S/C16H18N2O7S2/c1-15(2)9(12(22)23)18-13(24)16(25-3,14(18)27-15)17-10(19)8(11(20)21)7-4-5-26-6-7/h4-6,8-9,14H,1-3H3,(H,17,19)(H,20,21)(H,22,23)/p-2/t8?,9-,14+,16-/m0/s1 |
| InChIKey | BVCKFLJARNKCSS-DWPRYXJFSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temocillin(2−) (CHEBI:52438) is a dicarboxylic acid dianion (CHEBI:28965) |
| temocillin(2−) (CHEBI:52438) is conjugate base of temocillin (CHEBI:51817) |
| Incoming Relation(s) |
| temocillin disodium (CHEBI:52434) has part temocillin(2−) (CHEBI:52438) |
| temocillin (CHEBI:51817) is conjugate acid of temocillin(2−) (CHEBI:52438) |