EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O7S2 |
| Net Charge | 0 |
| Average Mass | 414.461 |
| Monoisotopic Mass | 414.05554 |
| SMILES | [H]C(C(=O)O)(C(=O)N[C@]1(OC)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@]21[H])c1ccsc1 |
| InChI | InChI=1S/C16H18N2O7S2/c1-15(2)9(12(22)23)18-13(24)16(25-3,14(18)27-15)17-10(19)8(11(20)21)7-4-5-26-6-7/h4-6,8-9,14H,1-3H3,(H,17,19)(H,20,21)(H,22,23)/t8?,9-,14+,16-/m0/s1 |
| InChIKey | BVCKFLJARNKCSS-DWPRYXJFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temocillin (CHEBI:51817) is a penicillin (CHEBI:17334) |
| temocillin (CHEBI:51817) is conjugate acid of temocillin(2−) (CHEBI:52438) |
| Incoming Relation(s) |
| temocillin(2−) (CHEBI:52438) is conjugate base of temocillin (CHEBI:51817) |
| IUPAC Name |
|---|
| 6β-[carboxy(thiophen-3-yl)acetamido]-6-methoxy-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| temocillina | ChemIDplus |
| temocilline | ChemIDplus |
| temocillinum | ChemIDplus |
| temocillin | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6S)-6-{[carboxy(thiophen-3-yl)acetyl]amino}-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| (2S,5R,6S)-6-{[carboxy(3-thienyl)acetyl]amino}-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| N-((2S,5R,6S)-2-carboxy-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo(3.2.0)hept-6-yl)-3-thiophenemalonamic acid | ChemIDplus |
| (2S,5R,6S)-6-[2-carboxy(thiophen-3-yl)acetamido]-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1094670 | Reaxys |
| CAS:66148-78-5 | ChemIDplus |
| Citations |
|---|