EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52316 - cordycepin triphosphate
| Formula | C10H16N5O12P3 |
| Net Charge | 0 |
| Average Mass | 491.183 |
| Monoisotopic Mass | 491.00083 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]1O |
| InChI | InChI=1S/C10H16N5O12P3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(16)1-5(25-10)2-24-29(20,21)27-30(22,23)26-28(17,18)19/h3-6,10,16H,1-2H2,(H,20,21)(H,22,23)(H2,11,12,13)(H2,17,18,19)/t5-,6+,10+/m0/s1 |
| InChIKey | NLIHPCYXRYQPSD-BAJZRUMYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral agent A substance that destroys or inhibits replication of viruses. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordycepin triphosphate (CHEBI:52316) has functional parent cordycepin (CHEBI:29014) |
| cordycepin triphosphate (CHEBI:52316) has role antifungal agent (CHEBI:35718) |
| cordycepin triphosphate (CHEBI:52316) has role antimetabolite (CHEBI:35221) |
| cordycepin triphosphate (CHEBI:52316) has role antineoplastic agent (CHEBI:35610) |
| cordycepin triphosphate (CHEBI:52316) has role antiviral agent (CHEBI:22587) |
| cordycepin triphosphate (CHEBI:52316) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| IUPAC Name |
|---|
| 3'-deoxyadenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 3'-Deoxyadenosine 5'-triphosphate | ChemIDplus |
| CoTP | ChEBI |