EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52316 - cordycepin triphosphate
| Formula | C10H16N5O12P3 |
| Net Charge | 0 |
| Average Mass | 491.183 |
| Monoisotopic Mass | 491.00083 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]1O |
| InChI | InChI=1S/C10H16N5O12P3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(16)1-5(25-10)2-24-29(20,21)27-30(22,23)26-28(17,18)19/h3-6,10,16H,1-2H2,(H,20,21)(H,22,23)(H2,11,12,13)(H2,17,18,19)/t5-,6+,10+/m0/s1 |
| InChIKey | NLIHPCYXRYQPSD-BAJZRUMYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antiviral agent A substance that destroys or inhibits replication of viruses. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordycepin triphosphate (CHEBI:52316) has functional parent cordycepin (CHEBI:29014) |
| cordycepin triphosphate (CHEBI:52316) has role antifungal agent (CHEBI:35718) |
| cordycepin triphosphate (CHEBI:52316) has role antimetabolite (CHEBI:35221) |
| cordycepin triphosphate (CHEBI:52316) has role antineoplastic agent (CHEBI:35610) |
| cordycepin triphosphate (CHEBI:52316) has role antiviral agent (CHEBI:22587) |
| cordycepin triphosphate (CHEBI:52316) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| IUPAC Name |
|---|
| 3'-deoxyadenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 3'-Deoxyadenosine 5'-triphosphate | ChemIDplus |
| CoTP | ChEBI |