EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O3 |
| Net Charge | 0 |
| Average Mass | 251.246 |
| Monoisotopic Mass | 251.10184 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1O |
| InChI | InChI=1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,10+/m0/s1 |
| InChIKey | OFEZSBMBBKLLBJ-BAJZRUMYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordycepin (CHEBI:29014) has role antimetabolite (CHEBI:35221) |
| cordycepin (CHEBI:29014) has role antineoplastic agent (CHEBI:35610) |
| cordycepin (CHEBI:29014) has role nucleoside antibiotic (CHEBI:25605) |
| cordycepin (CHEBI:29014) is a 3'-deoxyribonucleoside (CHEBI:36987) |
| cordycepin (CHEBI:29014) is a adenosines (CHEBI:22260) |
| Incoming Relation(s) |
| cordycepin triphosphate (CHEBI:52316) has functional parent cordycepin (CHEBI:29014) |
| IUPAC Name |
|---|
| 3'-deoxyadenosine |
| Synonyms | Source |
|---|---|
| 9-(beta-D-3'-Deoxyribofuranosyl)adenine | ChemIDplus |
| 9-Cordyceposidoadenine | ChemIDplus |
| 9H-Purine, 6-amino-9-(3-deoxy-beta-D-ribofuranosyl)- | ChemIDplus |
| Cordycepin | KEGG COMPOUND |
| Cordycepine | ChemIDplus |
| NSC-401022 | ChEMBL |
| UniProt Name | Source |
|---|---|
| cordycepin | UniProt |
| Citations |
|---|