EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H18 |
| Net Charge | 0 |
| Average Mass | 306.408 |
| Monoisotopic Mass | 306.14085 |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H18/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H |
| InChIKey | GPRIERYVMZVKTC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chromophore The part (atom or group of atoms) of a molecular entity in which the electronic transition responsible for a given spectral band is approximately localized. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-quaterphenyl (CHEBI:52240) has role chromophore (CHEBI:23240) |
| p-quaterphenyl (CHEBI:52240) is a benzenoid aromatic compound (CHEBI:33836) |
| IUPAC Name |
|---|
| 1,1':4',1'':4'',1'''-quaterphenyl |
| Synonyms | Source |
|---|---|
| 4,4'-diphenylbiphenyl | ChemIDplus |
| quadriphenyl | ChemIDplus |
| p-quaterphenyl | ChemIDplus |
| p-tetraphenyl | ChemIDplus |
| benzerythrene | ChemIDplus |
| 11,21:24,31:34,41-quaterphenyl | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 8353 | ChemSpider |
| DB12794 | DrugBank |
| JP2006248977 | Patent |
| Para-Quaterphenyl | Wikipedia |
| Citations |
|---|