EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H65N2 |
| Net Charge | +1 |
| Average Mass | 597.996 |
| Monoisotopic Mass | 597.51423 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)ccc3[C@@]1(C)CCC[C@@]2(C)CNCC[N+]([H])([H])C[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3CC[C@@]12[H] |
| InChI | InChI=1S/C42H64N2/c1-29(2)31-11-15-35-33(25-31)13-17-37-39(5,19-9-21-41(35,37)7)27-43-23-24-44-28-40(6)20-10-22-42(8)36-16-12-32(30(3)4)26-34(36)14-18-38(40)42/h11-12,15-16,25-26,29-30,37-38,43-44H,9-10,13-14,17-24,27-28H2,1-8H3/p+1/t37-,38-,39-,40-,41+,42+/m0/s1 |
| InChIKey | XGIHQYAWBCFNPY-AZOCGYLKSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrabamine(1+) (CHEBI:52170) is a ammonium ion derivative (CHEBI:35274) |
| hydrabamine(1+) (CHEBI:52170) is conjugate acid of hydrabamine (CHEBI:52166) |
| hydrabamine(1+) (CHEBI:52170) is conjugate base of hydrabamine(2+) (CHEBI:52171) |
| Incoming Relation(s) |
| hydrabamine(2+) (CHEBI:52171) is conjugate acid of hydrabamine(1+) (CHEBI:52170) |
| hydrabamine (CHEBI:52166) is conjugate base of hydrabamine(1+) (CHEBI:52170) |
| IUPAC Name |
|---|
| N-{2-[abieta-8(14),9(11),12-trien-18-ylamino]ethyl}abieta-8(14),9(11),12-trien-18-aminium |